-
-
-
Physical properties Key Physical Properties Value Condition Molecular Weight 669.72 - Density (Predicted) 1.35±0.1 g/cm3 Temp: 20 °C; Press: 760 Torr PKA (ennustatud) 9,16 ± 0,20 Kõige happelisem temp: 25 ° C Muud nimed ja identifikaatorid kanoonilised naeratused O=C1N=C(NC(=O)C(C)C)NC2=C1N=CN2C3OC(COC(C=4C=CC=CC4)(C5=CC=C(OC)C=C5)C6=CC=C(OC)C=C6)C(O)C3OC Isomeric SMILES C (OC [C@H] 1O [C@H] ([C@H] (OC) [C @@ h] 1o) n2c3 = c (n = c2) c (= o) n = c (nc (c (c) = o) n3) (c4 = cc = c (oc) c = c4) (c5 = c = c = c = c) c = c = c = c = c (c4) (C4) (C4) (C4) (C4) (C4) (C4) (C4) (C4) (C4) (C4) (C4) (C4) (C4) (C4) (C4 = C) (C4) (C4) (C5 = CC = C) (C4) (C4) (C4) (C5 = CC = C) ( -
-
Füüsikalised omadused Füüsikalised omadused Väärtus Tingimus molekulmass 687,74 - tihedus (ennustatud) 1,32 ± 0,1 g/cm3 temp: 20 ° C; Press: 760 Torr pKa (Predicted) 7.87±0.43 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O = c (nc1 = nc = nc2 = c1n = cn2c3oc (coc (c = 4c = cc4) (c5 = cc = c (c (oc) c = c5) c6 = c6 = cc = c (oc) c = c6) c (o) c3oc) c = 7c = 7c = cc7 isomeerne Smiles C(OC[C@H]1O[C@H]([C@H](OC)[C@@H]1O)N2C=3C(N=C2)=C(NC(=O)C4=CC=CC=C4)N=CN3)(C5=CC=C(OC)C=C5)(C6=CC=C(OC)C=C6) C7=CC=CC=C7 In... -
Substance Detail CAS Registry Number 473278-54-5 Key Physical Properties Value Condition Molecular Weight 341.32 - Boiling Point (Predicted) 715.0±70.0 °C Press: 760 Torr Density (Predicted) 1.81±0.1 g/cm3 Temp: 20 °C; Press: 760 Torr pKa (Predicted) 13.20±0.70 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1N=C(N)NC2=C1N=CN2C3OC(CO)C(O)C3OCCOC Isomeric SMILES O (CCOC) [c@h] 1 [c @@ h] (o [c@h] (co) [c@h] 1o) n2c3 = c (n = c2) c (= o) n = c (n) n3 tolli inci = 1s/c13H19n5o6/... -
-
Substance Detail CAS Registry Number 1262015-90-6 Key Physical Properties Value Condition Molecular Weight 411.41 - Density (Predicted) 1.460±0.06 g/cm3 Temp: 20 °C; Press: 760 Torr pKa (Predicted) 8.23±0.10 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1NC(=O)N(C=C1C(=O)NCC2=CC=CC=3C=CC=CC32)C4OC(CO)C(O)C4 Isomeric SMILES O = C1N (C = C (C (NCC = 2C3 = C (C = CC2) C = CC = CC = C3) = O) C (= O) N1) [c @@ h] 4o [c@h] (co) [c @@ h] (o) c4 inchi = 1S/C21H21N3O6/C25-16) ... -
-
-
Substance Detail CAS Registry Number 22423-26-3 Key Physical Properties Value Condition Molecular Weight 240.21 - Melting Point (Experimental) 218 °C Solvent: Ethanol; Isopropanooli keemistemperatuur (ennustatud) 452,0 ± 55,0 ° C Press: 760 Torr tihedus (ennustatud) 1,88 ± 0,1 g/cm3 temp: 20 ° C; Press: 760 Torr pKa (Predicted) 12.56±0.60 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1N=C2OC3C(O)C(OC3N2C=C1C)CO Isomeric SMILES O[C@H]1[C@]2([C@](N3C(O2)= NC(=O)C... -
